Organophosphorus compounds
eMolecules 224311-51-7 | 2-(Di-tert-butylphosphino)biphenyl | Combi-Blocks | MFCD01862440 | 298.410 | C20H27P | 98.000 | CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C | 100g | 296390907
2-(Di-tert-butylphosphino)biphenyl | Combi-Blocks | 224311-51-7 | MFCD01862440 | 298.410 | C20H27P | 98.000 | CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C | 100g | 296390907
eMolecules 564483-18-7 | 2-(Dicyclohexylphosphino)-2',4',6'-triisopropyl-1,1'-biphenyl | Oakwood Chemicals | MFCD04117682 | 476.729 | C33H49P | 95.000 | CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 480140943
2-(Dicyclohexylphosphino)-2',4',6'-triisopropyl-1,1'-biphenyl | Oakwood Chemicals | 564483-18-7 | MFCD04117682 | 476.729 | C33H49P | 95.000 | CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 480140943
Abcam Amifostine, cytoprotective agent, 10MG
MW 214.23 Da, Purity >98%. Broad spectrum cytoprotective agent. Inactive prodrug of WR-1065. In vitro effects include p53 activation and indirect activation of proteins, including Bcl-2 and HIF-1α, involved in DNA repair and apoptosis. .
The product is subject to the following: Abcam Restricted Use Statement
eMolecules 51805-45-9 | TRIS(2-CARBOXYETHYL)PHOSPHINE HCL | AstaTech | MFCD00145469 | 286.640 | C9H16ClO6P | 97.000 | Cl.OC(=O)CCP(CCC(O)=O)CCC(O)=O | 25g | 200612814
TRIS(2-CARBOXYETHYL)PHOSPHINE HCL | AstaTech | 51805-45-9 | MFCD00145469 | 286.640 | C9H16ClO6P | 97.000 | Cl.OC(=O)CCP(CCC(O)=O)CCC(O)=O | 25g | 200612814
eMolecules 51805-45-9 | Tris(2-carboxyethyl)phosphine hydrochloride | Apollo Scientific US | MFCD00145469 | 286.640 | C9H16ClO6P | 98.000 | Cl.OC(=O)CCP(CCC(O)=O)CCC(O)=O | 5g | 870070003
Tris(2-carboxyethyl)phosphine hydrochloride | Apollo Scientific US | 51805-45-9 | MFCD00145469 | 286.640 | C9H16ClO6P | 98.000 | Cl.OC(=O)CCP(CCC(O)=O)CCC(O)=O | 5g | 870070003
eMolecules 4559-70-0 | DIPHENYLPHOSPHINE OXIDE | AstaTech | MFCD00002079 | 202.193 | C12H11OP | 97.000 | O=P(c1ccccc1)c1ccccc1 | 50g | 449762047
DIPHENYLPHOSPHINE OXIDE | AstaTech | 4559-70-0 | MFCD00002079 | 202.193 | C12H11OP | 97.000 | O=P(c1ccccc1)c1ccccc1 | 50g | 449762047
eMolecules 16858-01-8 | Tris(2-pyridylmethyl)amine | Ambeed | MFCD14708176 | 290.370 | C18H18N4 | 97.000 | C(N(Cc1ccccn1)Cc1ccccn1)c1ccccn1 | 5g | 525180453
Tris(2-pyridylmethyl)amine | Ambeed | 16858-01-8 | MFCD14708176 | 290.370 | C18H18N4 | 97.000 | C(N(Cc1ccccn1)Cc1ccccn1)c1ccccn1 | 5g | 525180453
eMolecules 787618-22-8 | 2-Dicyclohexylphosphino-2,6-DI-I-Propoxy-1,1-Biphenyl | AA Blocks LLC | MFCD06798294 | 466.646 | C30H43O2P | 0.000 | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 100g | 560591953
2-Dicyclohexylphosphino-2,6-DI-I-Propoxy-1,1-Biphenyl | AA Blocks LLC | 787618-22-8 | MFCD06798294 | 466.646 | C30H43O2P | 0.000 | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 100g | 560591953
Strem, An Ascensus Company CAS# 3115-68-2. 100g. Tetra-n-butylphosphonium bromide, 98%. MFCD00011853
CAS# 3115-68-2. 100g. Tetra-n-butylphosphonium bromide, 98%. MFCD00011853. Molecular Weight: 339.35. Molecular Formula: (C4H9)4P+Brae. Color/form: white xtl. Strem# 93-1579. http://www.strem.com/catalog/v/93-1579/
![eMolecules ChemScene / DavePhos Pd G3 / 250mg / 536905582 / CS-0080670 / 0.000 / 1445085-87-9 / [null] / 762.280 / C39H48N2O3PPdS](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502485458.JPG-250.jpg)
eMolecules ChemScene / DavePhos Pd G3 / 250mg / 536905582 / CS-0080670 / 0.000 / 1445085-87-9 / [null] / 762.280 / C39H48N2O3PPdS
ChemScene / DavePhos Pd G3 / 250mg / 536905582 / CS-0080670 / 0.000 / 1445085-87-9 / [null] / 762.280 / C39H48N2O3PPdS
eMolecules 657408-07-6 | 2-Dicyclohexylphosphino-2',6'-dimethoxybiphenyl | Synthonix - Stock | MFCD05861611 | 410.538 | C26H35O2P | 95.000 | COc1cccc(OC)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 525914577
2-Dicyclohexylphosphino-2',6'-dimethoxybiphenyl | Synthonix - Stock | 657408-07-6 | MFCD05861611 | 410.538 | C26H35O2P | 95.000 | COc1cccc(OC)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 525914577